C29H33N3O3 — CID 101244113
ethyl 4-[(3S)-3-[4-(diethylamino)phenyl]-2-(4-methoxyphenyl)-3,4-dihydropyrazol-5-yl]benzoate (PubChem CID 101244113) has the molecular formula C29H33N3O3 and a molecular weight of 471.60 g/mol. Its IUPAC name is ethyl 4-[(3S)-3-[4-(diethylamino)phenyl]-2-(4-methoxyphenyl)-3,4-dihydropyrazol-5-yl]benzoate.
| Compound Name | ethyl 4-[(3S)-3-[4-(diethylamino)phenyl]-2-(4-methoxyphenyl)-3,4-dihydropyrazol-5-yl]benzoate |
|---|---|
| PubChem CID | 101244113 |
| Molecular Formula | C29H33N3O3 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | ethyl 4-[(3S)-3-[4-(diethylamino)phenyl]-2-(4-methoxyphenyl)-3,4-dihydropyrazol-5-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(C2=NN(c3ccc(OC)cc3)[C@H](c3ccc(N(CC)CC)cc3)C2)cc1 |
| InChI | InChI=1S/C29H33N3O3/c1-5-31(6-2)24-14-12-22(13-15-24)28-20-27(21-8-10-23(11-9-21)29(33)35-7-3)30-32(28)25-16-18-26(34-4)19-17-25/h8-19,28H,5-7,20H2,1-4H3/t28-/m0/s1 |
| InChIKey | PBZDNBGUYZWKHU-NDEPHWFRSA-N |
| XLogP | 6.07 |
| TPSA | 54.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|