C32H30N4O3 — CID 3808856
4-methoxy-N-[[4-[3-(4-methoxyphenyl)-5-(4-methylphenyl)-3,4-dihydropyrazol-2-yl]phenyl]methylideneamino]benzamide (PubChem CID 3808856) has the molecular formula C32H30N4O3 and a molecular weight of 518.62 g/mol. Its IUPAC name is 4-methoxy-N-[[4-[3-(4-methoxyphenyl)-5-(4-methylphenyl)-3,4-dihydropyrazol-2-yl]phenyl]methylideneamino]benzamide.
| Compound Name | 4-methoxy-N-[[4-[3-(4-methoxyphenyl)-5-(4-methylphenyl)-3,4-dihydropyrazol-2-yl]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 3808856 |
| Molecular Formula | C32H30N4O3 |
| Molecular Weight | 518.62 g/mol |
| Exact Mass | 518.23 |
| IUPAC Name | 4-methoxy-N-[[4-[3-(4-methoxyphenyl)-5-(4-methylphenyl)-3,4-dihydropyrazol-2-yl]phenyl]methylideneamino]benzamide |
| SMILES | COc1ccc(C(=O)NN=Cc2ccc(N3N=C(c4ccc(C)cc4)CC3c3ccc(OC)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H30N4O3/c1-22-4-8-24(9-5-22)30-20-31(25-10-16-28(38-2)17-11-25)36(35-30)27-14-6-23(7-15-27)21-33-34-32(37)26-12-18-29(39-3)19-13-26/h4-19,21,31H,20H2,1-3H3,(H,34,37) |
| InChIKey | QYJWPSMDQLVFCQ-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.62 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|