C31H28N4O2 — CID 3112547
N-[[4-[3-(4-methoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]phenyl]methylideneamino]-4-methylbenzamide (PubChem CID 3112547) has the molecular formula C31H28N4O2 and a molecular weight of 488.59 g/mol. Its IUPAC name is N-[[4-[3-(4-methoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]phenyl]methylideneamino]-4-methylbenzamide.
| Compound Name | N-[[4-[3-(4-methoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]phenyl]methylideneamino]-4-methylbenzamide |
|---|---|
| PubChem CID | 3112547 |
| Molecular Formula | C31H28N4O2 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | N-[[4-[3-(4-methoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]phenyl]methylideneamino]-4-methylbenzamide |
| SMILES | COc1ccc(C2CC(c3ccccc3)=NN2c2ccc(C=NNC(=O)c3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C31H28N4O2/c1-22-8-12-26(13-9-22)31(36)33-32-21-23-10-16-27(17-11-23)35-30(25-14-18-28(37-2)19-15-25)20-29(34-35)24-6-4-3-5-7-24/h3-19,21,30H,20H2,1-2H3,(H,33,36) |
| InChIKey | VCAPDCMPUPMHRS-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|