C30H27N5O2 — CID 51671903
N-[(E)-[4-[(3R)-3-(4-ethoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]phenyl]methylideneamino]pyridine-4-carboxamide (PubChem CID 51671903) has the molecular formula C30H27N5O2 and a molecular weight of 489.58 g/mol. Its IUPAC name is N-[(E)-[4-[(3R)-3-(4-ethoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]phenyl]methylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[(E)-[4-[(3R)-3-(4-ethoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]phenyl]methylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 51671903 |
| Molecular Formula | C30H27N5O2 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | N-[(E)-[4-[(3R)-3-(4-ethoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]phenyl]methylideneamino]pyridine-4-carboxamide |
| SMILES | CCOc1ccc([C@H]2CC(c3ccccc3)=NN2c2ccc(/C=N/NC(=O)c3ccncc3)cc2)cc1 |
| InChI | InChI=1S/C30H27N5O2/c1-2-37-27-14-10-24(11-15-27)29-20-28(23-6-4-3-5-7-23)34-35(29)26-12-8-22(9-13-26)21-32-33-30(36)25-16-18-31-19-17-25/h3-19,21,29H,2,20H2,1H3,(H,33,36)/b32-21+/t29-/m1/s1 |
| InChIKey | VJLGECCEYYZFGA-PUFQGMHOSA-N |
| XLogP | 5.60 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|