C31H28N2O7 — CID 154028014
ethyl 4-[2-(4-ethoxycarbonylphenyl)-5-(6-methoxy-2-oxochromen-3-yl)-3,4-dihydropyrazol-3-yl]benzoate (PubChem CID 154028014) has the molecular formula C31H28N2O7 and a molecular weight of 540.57 g/mol. Its IUPAC name is ethyl 4-[2-(4-ethoxycarbonylphenyl)-5-(6-methoxy-2-oxochromen-3-yl)-3,4-dihydropyrazol-3-yl]benzoate.
| Compound Name | ethyl 4-[2-(4-ethoxycarbonylphenyl)-5-(6-methoxy-2-oxochromen-3-yl)-3,4-dihydropyrazol-3-yl]benzoate |
|---|---|
| PubChem CID | 154028014 |
| Molecular Formula | C31H28N2O7 |
| Molecular Weight | 540.57 g/mol |
| Exact Mass | 540.19 |
| IUPAC Name | ethyl 4-[2-(4-ethoxycarbonylphenyl)-5-(6-methoxy-2-oxochromen-3-yl)-3,4-dihydropyrazol-3-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(C2CC(c3cc4cc(OC)ccc4oc3=O)=NN2c2ccc(C(=O)OCC)cc2)cc1 |
| InChI | InChI=1S/C31H28N2O7/c1-4-38-29(34)20-8-6-19(7-9-20)27-18-26(25-17-22-16-24(37-3)14-15-28(22)40-31(25)36)32-33(27)23-12-10-21(11-13-23)30(35)39-5-2/h6-17,27H,4-5,18H2,1-3H3 |
| InChIKey | UIZCMXOQWXCLGU-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 107.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.57 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|