C30H23N3O7 — CID 154028008
(2,5-dioxopyrrolidin-1-yl) 4-[5-(6-methoxy-2-oxochromen-3-yl)-3-phenyl-3,4-dihydropyrazol-2-yl]benzoate (PubChem CID 154028008) has the molecular formula C30H23N3O7 and a molecular weight of 537.53 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[5-(6-methoxy-2-oxochromen-3-yl)-3-phenyl-3,4-dihydropyrazol-2-yl]benzoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[5-(6-methoxy-2-oxochromen-3-yl)-3-phenyl-3,4-dihydropyrazol-2-yl]benzoate |
|---|---|
| PubChem CID | 154028008 |
| Molecular Formula | C30H23N3O7 |
| Molecular Weight | 537.53 g/mol |
| Exact Mass | 537.15 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[5-(6-methoxy-2-oxochromen-3-yl)-3-phenyl-3,4-dihydropyrazol-2-yl]benzoate |
| SMILES | COc1ccc2oc(=O)c(C3=NN(c4ccc(C(=O)ON5C(=O)CCC5=O)cc4)C(c4ccccc4)C3)cc2c1 |
| InChI | InChI=1S/C30H23N3O7/c1-38-22-11-12-26-20(15-22)16-23(30(37)39-26)24-17-25(18-5-3-2-4-6-18)32(31-24)21-9-7-19(8-10-21)29(36)40-33-27(34)13-14-28(33)35/h2-12,15-16,25H,13-14,17H2,1H3 |
| InChIKey | KAGIJXSNOBGPQK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 118.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.53 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|