C25H22N2O2 — CID 7349365
(E)-3-[(3R)-2,3-diphenyl-3,4-dihydropyrazol-5-yl]-1-(4-methoxyphenyl)prop-2-en-1-one (PubChem CID 7349365) has the molecular formula C25H22N2O2 and a molecular weight of 382.46 g/mol. Its IUPAC name is (E)-3-[(3R)-2,3-diphenyl-3,4-dihydropyrazol-5-yl]-1-(4-methoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[(3R)-2,3-diphenyl-3,4-dihydropyrazol-5-yl]-1-(4-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 7349365 |
| Molecular Formula | C25H22N2O2 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | (E)-3-[(3R)-2,3-diphenyl-3,4-dihydropyrazol-5-yl]-1-(4-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C/C2=NN(c3ccccc3)[C@@H](c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C25H22N2O2/c1-29-23-15-12-20(13-16-23)25(28)17-14-21-18-24(19-8-4-2-5-9-19)27(26-21)22-10-6-3-7-11-22/h2-17,24H,18H2,1H3/b17-14+/t24-/m1/s1 |
| InChIKey | NXDXYTZWZMACRQ-CQLKWFSRSA-N |
| XLogP | 5.44 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|