C24H19BrN2O — CID 92846863
(E)-1-(4-bromophenyl)-3-[(3R)-2,3-diphenyl-3,4-dihydropyrazol-5-yl]prop-2-en-1-one (PubChem CID 92846863) has the molecular formula C24H19BrN2O and a molecular weight of 431.33 g/mol. Its IUPAC name is (E)-1-(4-bromophenyl)-3-[(3R)-2,3-diphenyl-3,4-dihydropyrazol-5-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-bromophenyl)-3-[(3R)-2,3-diphenyl-3,4-dihydropyrazol-5-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 92846863 |
| Molecular Formula | C24H19BrN2O |
| Molecular Weight | 431.33 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | (E)-1-(4-bromophenyl)-3-[(3R)-2,3-diphenyl-3,4-dihydropyrazol-5-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/C1=NN(c2ccccc2)[C@@H](c2ccccc2)C1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C24H19BrN2O/c25-20-13-11-19(12-14-20)24(28)16-15-21-17-23(18-7-3-1-4-8-18)27(26-21)22-9-5-2-6-10-22/h1-16,23H,17H2/b16-15+/t23-/m1/s1 |
| InChIKey | SHRIWFBMSXEZQC-POICXBNUSA-N |
| XLogP | 6.20 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.33 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|