C16H13N2NaO2 — CID 24844262
sodium 2,3-diphenyl-3,4-dihydropyrazole-5-carboxylate (PubChem CID 24844262) has the molecular formula C16H13N2NaO2 and a molecular weight of 288.28 g/mol. Its IUPAC name is sodium 2,3-diphenyl-3,4-dihydropyrazole-5-carboxylate.
| Compound Name | sodium 2,3-diphenyl-3,4-dihydropyrazole-5-carboxylate |
|---|---|
| PubChem CID | 24844262 |
| Molecular Formula | C16H13N2NaO2 |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | sodium 2,3-diphenyl-3,4-dihydropyrazole-5-carboxylate |
| SMILES | O=C([O-])C1=NN(c2ccccc2)C(c2ccccc2)C1.[Na+] |
| InChI | InChI=1S/C16H14N2O2.Na/c19-16(20)14-11-15(12-7-3-1-4-8-12)18(17-14)13-9-5-2-6-10-13;/h1-10,15H,11H2,(H,19,20);/q;+1/p-1 |
| InChIKey | LFILQNOYXWPXFS-UHFFFAOYSA-M |
| XLogP | -1.25 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |