About (3R)-N-methoxy-2,3-diphenyl-3,4-dihydropyrazole-5-carboxamide
(3R)-N-methoxy-2,3-diphenyl-3,4-dihydropyrazole-5-carboxamide (PubChem CID 38013267) has the molecular formula C17H17N3O2
and a molecular weight of 295.34 g/mol. Its IUPAC name is (3R)-N-methoxy-2,3-diphenyl-3,4-dihydropyrazole-5-carboxamide.
Molecular Properties
| Compound Name | (3R)-N-methoxy-2,3-diphenyl-3,4-dihydropyrazole-5-carboxamide |
| PubChem CID | 38013267 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | (3R)-N-methoxy-2,3-diphenyl-3,4-dihydropyrazole-5-carboxamide |
| SMILES | CONC(=O)C1=NN(c2ccccc2)[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C17H17N3O2/c1-22-19-17(21)15-12-16(13-8-4-2-5-9-13)20(18-15)14-10-6-3-7-11-14/h2-11,16H,12H2,1H3,(H,19,21)/t16-/m1/s1 |
| InChIKey | XYLRXHSVQRULIK-MRXNPFEDSA-N |
| XLogP | 2.67 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3R)-N-methoxy-2,3-diphenyl-3,4-dihydropyrazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-N-methoxy-2,3-diphenyl-3,4-dihydropyrazole-5-carboxamide?
The IUPAC name of (3R)-N-methoxy-2,3-diphenyl-3,4-dihydropyrazole-5-carboxamide (CID 38013267) is (3R)-N-methoxy-2,3-diphenyl-3,4-dihydropyrazole-5-carboxamide.
What is the SMILES notation for (3R)-N-methoxy-2,3-diphenyl-3,4-dihydropyrazole-5-carboxamide?
The canonical SMILES for (3R)-N-methoxy-2,3-diphenyl-3,4-dihydropyrazole-5-carboxamide is CONC(=O)C1=NN(c2ccccc2)[C@@H](c2ccccc2)C1.
What is the InChIKey of (3R)-N-methoxy-2,3-diphenyl-3,4-dihydropyrazole-5-carboxamide?
The InChIKey is XYLRXHSVQRULIK-MRXNPFEDSA-N. The full InChI is InChI=1S/C17H17N3O2/c1-22-19-17(21)15-12-16(13-8-4-2-5-9-13)20(18-15)14-10-6-3-7-11-14/h2-11,16H,12H2,1H3,(H,19,21)/t16-/m1/s1.
What are the key properties of (3R)-N-methoxy-2,3-diphenyl-3,4-dihydropyrazole-5-carboxamide?
(3R)-N-methoxy-2,3-diphenyl-3,4-dihydropyrazole-5-carboxamide has a molecular weight of 295.34 g/mol, XLogP of 2.67, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-N-methoxy-2,3-diphenyl-3,4-dihydropyrazole-5-carboxamide is sourced from PubChem (CID 38013267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).