C19H16N4OS — CID 42888150
2,3-diphenyl-N-(1,3-thiazol-2-yl)-3,4-dihydropyrazole-5-carboxamide (PubChem CID 42888150) has the molecular formula C19H16N4OS and a molecular weight of 348.43 g/mol. Its IUPAC name is 2,3-diphenyl-N-(1,3-thiazol-2-yl)-3,4-dihydropyrazole-5-carboxamide.
| Compound Name | 2,3-diphenyl-N-(1,3-thiazol-2-yl)-3,4-dihydropyrazole-5-carboxamide |
|---|---|
| PubChem CID | 42888150 |
| Molecular Formula | C19H16N4OS |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 2,3-diphenyl-N-(1,3-thiazol-2-yl)-3,4-dihydropyrazole-5-carboxamide |
| SMILES | O=C(Nc1nccs1)C1=NN(c2ccccc2)C(c2ccccc2)C1 |
| InChI | InChI=1S/C19H16N4OS/c24-18(21-19-20-11-12-25-19)16-13-17(14-7-3-1-4-8-14)23(22-16)15-9-5-2-6-10-15/h1-12,17H,13H2,(H,20,21,24) |
| InChIKey | KERJYMAUPQOAFO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 57.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |