C21H18N4O — CID 39997388
(3S)-2,3-diphenyl-N-pyridin-3-yl-3,4-dihydropyrazole-5-carboxamide (PubChem CID 39997388) has the molecular formula C21H18N4O and a molecular weight of 342.40 g/mol. Its IUPAC name is (3S)-2,3-diphenyl-N-pyridin-3-yl-3,4-dihydropyrazole-5-carboxamide.
| Compound Name | (3S)-2,3-diphenyl-N-pyridin-3-yl-3,4-dihydropyrazole-5-carboxamide |
|---|---|
| PubChem CID | 39997388 |
| Molecular Formula | C21H18N4O |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | (3S)-2,3-diphenyl-N-pyridin-3-yl-3,4-dihydropyrazole-5-carboxamide |
| SMILES | O=C(Nc1cccnc1)C1=NN(c2ccccc2)[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C21H18N4O/c26-21(23-17-10-7-13-22-15-17)19-14-20(16-8-3-1-4-9-16)25(24-19)18-11-5-2-6-12-18/h1-13,15,20H,14H2,(H,23,26)/t20-/m0/s1 |
| InChIKey | PQQFCKSZLBQASA-FQEVSTJZSA-N |
| XLogP | 4.03 |
| TPSA | 57.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |