C28H31N3O2 — CID 164610273
N-butyl-4-[3-(4-methoxyphenyl)-5-(2-methylphenyl)-3,4-dihydropyrazol-2-yl]benzamide (PubChem CID 164610273) has the molecular formula C28H31N3O2 and a molecular weight of 441.58 g/mol. Its IUPAC name is N-butyl-4-[3-(4-methoxyphenyl)-5-(2-methylphenyl)-3,4-dihydropyrazol-2-yl]benzamide.
| Compound Name | N-butyl-4-[3-(4-methoxyphenyl)-5-(2-methylphenyl)-3,4-dihydropyrazol-2-yl]benzamide |
|---|---|
| PubChem CID | 164610273 |
| Molecular Formula | C28H31N3O2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | N-butyl-4-[3-(4-methoxyphenyl)-5-(2-methylphenyl)-3,4-dihydropyrazol-2-yl]benzamide |
| SMILES | CCCCNC(=O)c1ccc(N2N=C(c3ccccc3C)CC2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C28H31N3O2/c1-4-5-18-29-28(32)22-10-14-23(15-11-22)31-27(21-12-16-24(33-3)17-13-21)19-26(30-31)25-9-7-6-8-20(25)2/h6-17,27H,4-5,18-19H2,1-3H3,(H,29,32) |
| InChIKey | GOAYQAMTBWZGSC-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|