C16H15ClN2 — CID 102160984
(3S)-3-(4-chlorophenyl)-5-methyl-2-phenyl-3,4-dihydropyrazole (PubChem CID 102160984) has the molecular formula C16H15ClN2 and a molecular weight of 270.76 g/mol. Its IUPAC name is (3S)-3-(4-chlorophenyl)-5-methyl-2-phenyl-3,4-dihydropyrazole.
| Compound Name | (3S)-3-(4-chlorophenyl)-5-methyl-2-phenyl-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 102160984 |
| Molecular Formula | C16H15ClN2 |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | (3S)-3-(4-chlorophenyl)-5-methyl-2-phenyl-3,4-dihydropyrazole |
| SMILES | CC1=NN(c2ccccc2)[C@H](c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C16H15ClN2/c1-12-11-16(13-7-9-14(17)10-8-13)19(18-12)15-5-3-2-4-6-15/h2-10,16H,11H2,1H3/t16-/m0/s1 |
| InChIKey | CVSLZHLORRKDED-INIZCTEOSA-N |
| XLogP | 4.67 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |