C28H23ClN2 — CID 7392937
(3S)-5-(4-benzylphenyl)-3-(4-chlorophenyl)-2-phenyl-3,4-dihydropyrazole (PubChem CID 7392937) has the molecular formula C28H23ClN2 and a molecular weight of 422.96 g/mol. Its IUPAC name is (3S)-5-(4-benzylphenyl)-3-(4-chlorophenyl)-2-phenyl-3,4-dihydropyrazole.
| Compound Name | (3S)-5-(4-benzylphenyl)-3-(4-chlorophenyl)-2-phenyl-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 7392937 |
| Molecular Formula | C28H23ClN2 |
| Molecular Weight | 422.96 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | (3S)-5-(4-benzylphenyl)-3-(4-chlorophenyl)-2-phenyl-3,4-dihydropyrazole |
| SMILES | Clc1ccc([C@@H]2CC(c3ccc(Cc4ccccc4)cc3)=NN2c2ccccc2)cc1 |
| InChI | InChI=1S/C28H23ClN2/c29-25-17-15-24(16-18-25)28-20-27(30-31(28)26-9-5-2-6-10-26)23-13-11-22(12-14-23)19-21-7-3-1-4-8-21/h1-18,28H,19-20H2/t28-/m0/s1 |
| InChIKey | WSDVRVOTMIJNSB-NDEPHWFRSA-N |
| XLogP | 7.29 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.96 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |