C17H17N2O2S- — CID 174449441
[4-(5-methyl-2-phenyl-3,4-dihydropyrazol-3-yl)phenyl]methanesulfinate (PubChem CID 174449441) has the molecular formula C17H17N2O2S- and a molecular weight of 313.40 g/mol. Its IUPAC name is [4-(5-methyl-2-phenyl-3,4-dihydropyrazol-3-yl)phenyl]methanesulfinate.
| Compound Name | [4-(5-methyl-2-phenyl-3,4-dihydropyrazol-3-yl)phenyl]methanesulfinate |
|---|---|
| PubChem CID | 174449441 |
| Molecular Formula | C17H17N2O2S- |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | [4-(5-methyl-2-phenyl-3,4-dihydropyrazol-3-yl)phenyl]methanesulfinate |
| SMILES | CC1=NN(c2ccccc2)C(c2ccc(CS(=O)[O-])cc2)C1 |
| InChI | InChI=1S/C17H18N2O2S/c1-13-11-17(19(18-13)16-5-3-2-4-6-16)15-9-7-14(8-10-15)12-22(20)21/h2-10,17H,11-12H2,1H3,(H,20,21)/p-1 |
| InChIKey | ARZZGEZBNFHWCA-UHFFFAOYSA-M |
| XLogP | 3.39 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|