C15H15N3 — CID 92982843
(3S)-2,3-diphenyl-3,4-dihydropyrazol-5-amine (PubChem CID 92982843) has the molecular formula C15H15N3 and a molecular weight of 237.31 g/mol. Its IUPAC name is (3S)-2,3-diphenyl-3,4-dihydropyrazol-5-amine.
| Compound Name | (3S)-2,3-diphenyl-3,4-dihydropyrazol-5-amine |
|---|---|
| PubChem CID | 92982843 |
| Molecular Formula | C15H15N3 |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | (3S)-2,3-diphenyl-3,4-dihydropyrazol-5-amine |
| SMILES | NC1=NN(c2ccccc2)[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C15H15N3/c16-15-11-14(12-7-3-1-4-8-12)18(17-15)13-9-5-2-6-10-13/h1-10,14H,11H2,(H2,16,17)/t14-/m0/s1 |
| InChIKey | XOUOFYWYDVOBNR-AWEZNQCLSA-N |
| XLogP | 2.91 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |