C21H16Cl2N2 — CID 170722101
5-(2,6-dichlorophenyl)-2,3-diphenyl-3,4-dihydropyrazole (PubChem CID 170722101) has the molecular formula C21H16Cl2N2 and a molecular weight of 367.28 g/mol. Its IUPAC name is 5-(2,6-dichlorophenyl)-2,3-diphenyl-3,4-dihydropyrazole.
| Compound Name | 5-(2,6-dichlorophenyl)-2,3-diphenyl-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 170722101 |
| Molecular Formula | C21H16Cl2N2 |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 5-(2,6-dichlorophenyl)-2,3-diphenyl-3,4-dihydropyrazole |
| SMILES | Clc1cccc(Cl)c1C1=NN(c2ccccc2)C(c2ccccc2)C1 |
| InChI | InChI=1S/C21H16Cl2N2/c22-17-12-7-13-18(23)21(17)19-14-20(15-8-3-1-4-9-15)25(24-19)16-10-5-2-6-11-16/h1-13,20H,14H2 |
| InChIKey | ZYAFKOYWLJKEQV-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |