C24H25N3 — CID 11405575
N,N-dimethyl-4-[5-(2-methylphenyl)-2-phenyl-3,4-dihydropyrazol-3-yl]aniline (PubChem CID 11405575) has the molecular formula C24H25N3 and a molecular weight of 355.49 g/mol. Its IUPAC name is N,N-dimethyl-4-[5-(2-methylphenyl)-2-phenyl-3,4-dihydropyrazol-3-yl]aniline.
| Compound Name | N,N-dimethyl-4-[5-(2-methylphenyl)-2-phenyl-3,4-dihydropyrazol-3-yl]aniline |
|---|---|
| PubChem CID | 11405575 |
| Molecular Formula | C24H25N3 |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | N,N-dimethyl-4-[5-(2-methylphenyl)-2-phenyl-3,4-dihydropyrazol-3-yl]aniline |
| SMILES | Cc1ccccc1C1=NN(c2ccccc2)C(c2ccc(N(C)C)cc2)C1 |
| InChI | InChI=1S/C24H25N3/c1-18-9-7-8-12-22(18)23-17-24(19-13-15-20(16-14-19)26(2)3)27(25-23)21-10-5-4-6-11-21/h4-16,24H,17H2,1-3H3 |
| InChIKey | SYALXCVGJYPRTK-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|