C34H30N4 — CID 3743564
N,N-dimethyl-4-[5-[3-(naphthalen-1-ylmethylideneamino)phenyl]-2-phenyl-3,4-dihydropyrazol-3-yl]aniline (PubChem CID 3743564) has the molecular formula C34H30N4 and a molecular weight of 494.64 g/mol. Its IUPAC name is N,N-dimethyl-4-[5-[3-(naphthalen-1-ylmethylideneamino)phenyl]-2-phenyl-3,4-dihydropyrazol-3-yl]aniline.
| Compound Name | N,N-dimethyl-4-[5-[3-(naphthalen-1-ylmethylideneamino)phenyl]-2-phenyl-3,4-dihydropyrazol-3-yl]aniline |
|---|---|
| PubChem CID | 3743564 |
| Molecular Formula | C34H30N4 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | N,N-dimethyl-4-[5-[3-(naphthalen-1-ylmethylideneamino)phenyl]-2-phenyl-3,4-dihydropyrazol-3-yl]aniline |
| SMILES | CN(C)c1ccc(C2CC(c3cccc(/N=C/c4cccc5ccccc45)c3)=NN2c2ccccc2)cc1 |
| InChI | InChI=1S/C34H30N4/c1-37(2)30-20-18-26(19-21-30)34-23-33(36-38(34)31-15-4-3-5-16-31)27-12-9-14-29(22-27)35-24-28-13-8-11-25-10-6-7-17-32(25)28/h3-22,24,34H,23H2,1-2H3/b35-24+ |
| InChIKey | RAZZLMNZNAUVRJ-JWHWKPFMSA-N |
| XLogP | 8.01 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|