C36H30N6S — CID 16736473
N,N-dimethyl-4-[2-(4-naphthalen-2-yl-5-phenyldiazenyl-1,3-thiazol-2-yl)-5-phenyl-3,4-dihydropyrazol-3-yl]aniline (PubChem CID 16736473) has the molecular formula C36H30N6S and a molecular weight of 578.75 g/mol. Its IUPAC name is N,N-dimethyl-4-[2-(4-naphthalen-2-yl-5-phenyldiazenyl-1,3-thiazol-2-yl)-5-phenyl-3,4-dihydropyrazol-3-yl]aniline.
| Compound Name | N,N-dimethyl-4-[2-(4-naphthalen-2-yl-5-phenyldiazenyl-1,3-thiazol-2-yl)-5-phenyl-3,4-dihydropyrazol-3-yl]aniline |
|---|---|
| PubChem CID | 16736473 |
| Molecular Formula | C36H30N6S |
| Molecular Weight | 578.75 g/mol |
| Exact Mass | 578.23 |
| IUPAC Name | N,N-dimethyl-4-[2-(4-naphthalen-2-yl-5-phenyldiazenyl-1,3-thiazol-2-yl)-5-phenyl-3,4-dihydropyrazol-3-yl]aniline |
| SMILES | CN(C)c1ccc(C2CC(c3ccccc3)=NN2c2nc(-c3ccc4ccccc4c3)c(/N=N/c3ccccc3)s2)cc1 |
| InChI | InChI=1S/C36H30N6S/c1-41(2)31-21-19-27(20-22-31)33-24-32(26-12-5-3-6-13-26)40-42(33)36-37-34(29-18-17-25-11-9-10-14-28(25)23-29)35(43-36)39-38-30-15-7-4-8-16-30/h3-23,33H,24H2,1-2H3/b39-38+ |
| InChIKey | MOSWDUWLPFFQOP-YMZYAJTMSA-N |
| XLogP | 9.80 |
| TPSA | 56.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.75 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|