C22H21N3O — CID 765180
(3S)-3-[4-(dimethylamino)phenyl]-5-naphthalen-2-yl-3,4-dihydropyrazole-2-carbaldehyde (PubChem CID 765180) has the molecular formula C22H21N3O and a molecular weight of 343.43 g/mol. Its IUPAC name is (3S)-3-[4-(dimethylamino)phenyl]-5-naphthalen-2-yl-3,4-dihydropyrazole-2-carbaldehyde.
| Compound Name | (3S)-3-[4-(dimethylamino)phenyl]-5-naphthalen-2-yl-3,4-dihydropyrazole-2-carbaldehyde |
|---|---|
| PubChem CID | 765180 |
| Molecular Formula | C22H21N3O |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | (3S)-3-[4-(dimethylamino)phenyl]-5-naphthalen-2-yl-3,4-dihydropyrazole-2-carbaldehyde |
| SMILES | CN(C)c1ccc([C@@H]2CC(c3ccc4ccccc4c3)=NN2C=O)cc1 |
| InChI | InChI=1S/C22H21N3O/c1-24(2)20-11-9-17(10-12-20)22-14-21(23-25(22)15-26)19-8-7-16-5-3-4-6-18(16)13-19/h3-13,15,22H,14H2,1-2H3/t22-/m0/s1 |
| InChIKey | FDPONJJLQZLEFM-QFIPXVFZSA-N |
| XLogP | 4.21 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|