C23H16ClN3OS2 — CID 127050472
(5Z)-5-[[3-(4-chlorophenyl)-5-naphthalen-2-yl-3,4-dihydropyrazol-2-yl]methylidene]-4-sulfanylidene-1,3-thiazolidin-2-one (PubChem CID 127050472) has the molecular formula C23H16ClN3OS2 and a molecular weight of 449.99 g/mol. Its IUPAC name is (5Z)-5-[[3-(4-chlorophenyl)-5-naphthalen-2-yl-3,4-dihydropyrazol-2-yl]methylidene]-4-sulfanylidene-1,3-thiazolidin-2-one.
| Compound Name | (5Z)-5-[[3-(4-chlorophenyl)-5-naphthalen-2-yl-3,4-dihydropyrazol-2-yl]methylidene]-4-sulfanylidene-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 127050472 |
| Molecular Formula | C23H16ClN3OS2 |
| Molecular Weight | 449.99 g/mol |
| Exact Mass | 449.04 |
| IUPAC Name | (5Z)-5-[[3-(4-chlorophenyl)-5-naphthalen-2-yl-3,4-dihydropyrazol-2-yl]methylidene]-4-sulfanylidene-1,3-thiazolidin-2-one |
| SMILES | O=C1NC(=S)/C(=C/N2N=C(c3ccc4ccccc4c3)CC2c2ccc(Cl)cc2)S1 |
| InChI | InChI=1S/C23H16ClN3OS2/c24-18-9-7-15(8-10-18)20-12-19(17-6-5-14-3-1-2-4-16(14)11-17)26-27(20)13-21-22(29)25-23(28)30-21/h1-11,13,20H,12H2,(H,25,28,29)/b21-13- |
| InChIKey | HLKRZUCIUFKSEY-BKUYFWCQSA-N |
| XLogP | 6.27 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.99 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|