C30H22ClN3OS — CID 50740833
(5Z)-2-[3-(4-chlorophenyl)-5-naphthalen-2-yl-3,4-dihydropyrazol-2-yl]-5-[(2-methylphenyl)methylidene]-1,3-thiazol-4-one (PubChem CID 50740833) has the molecular formula C30H22ClN3OS and a molecular weight of 508.05 g/mol. Its IUPAC name is (5Z)-2-[3-(4-chlorophenyl)-5-naphthalen-2-yl-3,4-dihydropyrazol-2-yl]-5-[(2-methylphenyl)methylidene]-1,3-thiazol-4-one.
| Compound Name | (5Z)-2-[3-(4-chlorophenyl)-5-naphthalen-2-yl-3,4-dihydropyrazol-2-yl]-5-[(2-methylphenyl)methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 50740833 |
| Molecular Formula | C30H22ClN3OS |
| Molecular Weight | 508.05 g/mol |
| Exact Mass | 507.12 |
| IUPAC Name | (5Z)-2-[3-(4-chlorophenyl)-5-naphthalen-2-yl-3,4-dihydropyrazol-2-yl]-5-[(2-methylphenyl)methylidene]-1,3-thiazol-4-one |
| SMILES | Cc1ccccc1/C=C1\SC(N2N=C(c3ccc4ccccc4c3)CC2c2ccc(Cl)cc2)=NC1=O |
| InChI | InChI=1S/C30H22ClN3OS/c1-19-6-2-3-8-22(19)17-28-29(35)32-30(36-28)34-27(21-12-14-25(31)15-13-21)18-26(33-34)24-11-10-20-7-4-5-9-23(20)16-24/h2-17,27H,18H2,1H3/b28-17- |
| InChIKey | VYXFSTJDHRQJSW-QRQIAZFYSA-N |
| XLogP | 7.62 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.05 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|