C27H22FN3O3S — CID 50740655
(5Z)-2-[3,5-bis(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-5-[(4-fluorophenyl)methylidene]-1,3-thiazol-4-one (PubChem CID 50740655) has the molecular formula C27H22FN3O3S and a molecular weight of 487.56 g/mol. Its IUPAC name is (5Z)-2-[3,5-bis(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-5-[(4-fluorophenyl)methylidene]-1,3-thiazol-4-one.
| Compound Name | (5Z)-2-[3,5-bis(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-5-[(4-fluorophenyl)methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 50740655 |
| Molecular Formula | C27H22FN3O3S |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | (5Z)-2-[3,5-bis(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-5-[(4-fluorophenyl)methylidene]-1,3-thiazol-4-one |
| SMILES | COc1ccc(C2=NN(C3=NC(=O)/C(=C/c4ccc(F)cc4)S3)C(c3ccc(OC)cc3)C2)cc1 |
| InChI | InChI=1S/C27H22FN3O3S/c1-33-21-11-5-18(6-12-21)23-16-24(19-7-13-22(34-2)14-8-19)31(30-23)27-29-26(32)25(35-27)15-17-3-9-20(28)10-4-17/h3-15,24H,16H2,1-2H3/b25-15- |
| InChIKey | HQHNFDCTJPJQSQ-MYYYXRDXSA-N |
| XLogP | 5.66 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|