C28H26N4O3S — CID 50740899
(5Z)-2-[3-[4-(dimethylamino)phenyl]-5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-5-[(2-hydroxyphenyl)methylidene]-1,3-thiazol-4-one (PubChem CID 50740899) has the molecular formula C28H26N4O3S and a molecular weight of 498.61 g/mol. Its IUPAC name is (5Z)-2-[3-[4-(dimethylamino)phenyl]-5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-5-[(2-hydroxyphenyl)methylidene]-1,3-thiazol-4-one.
| Compound Name | (5Z)-2-[3-[4-(dimethylamino)phenyl]-5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-5-[(2-hydroxyphenyl)methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 50740899 |
| Molecular Formula | C28H26N4O3S |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | (5Z)-2-[3-[4-(dimethylamino)phenyl]-5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-5-[(2-hydroxyphenyl)methylidene]-1,3-thiazol-4-one |
| SMILES | COc1ccc(C2=NN(C3=NC(=O)/C(=C/c4ccccc4O)S3)C(c3ccc(N(C)C)cc3)C2)cc1 |
| InChI | InChI=1S/C28H26N4O3S/c1-31(2)21-12-8-19(9-13-21)24-17-23(18-10-14-22(35-3)15-11-18)30-32(24)28-29-27(34)26(36-28)16-20-6-4-5-7-25(20)33/h4-16,24,33H,17H2,1-3H3/b26-16- |
| InChIKey | OCSDHCYJRPLPPU-QQXSKIMKSA-N |
| XLogP | 5.29 |
| TPSA | 77.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|