C20H17N3O5S — CID 7870189
methyl (2Z)-2-[2-[(3R)-5-(furan-2-yl)-3-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-4-oxo-1,3-thiazol-5-ylidene]acetate (PubChem CID 7870189) has the molecular formula C20H17N3O5S and a molecular weight of 411.44 g/mol. Its IUPAC name is methyl (2Z)-2-[2-[(3R)-5-(furan-2-yl)-3-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-4-oxo-1,3-thiazol-5-ylidene]acetate.
| Compound Name | methyl (2Z)-2-[2-[(3R)-5-(furan-2-yl)-3-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-4-oxo-1,3-thiazol-5-ylidene]acetate |
|---|---|
| PubChem CID | 7870189 |
| Molecular Formula | C20H17N3O5S |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | methyl (2Z)-2-[2-[(3R)-5-(furan-2-yl)-3-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-4-oxo-1,3-thiazol-5-ylidene]acetate |
| SMILES | COC(=O)/C=C1\SC(N2N=C(c3ccco3)C[C@@H]2c2ccc(OC)cc2)=NC1=O |
| InChI | InChI=1S/C20H17N3O5S/c1-26-13-7-5-12(6-8-13)15-10-14(16-4-3-9-28-16)22-23(15)20-21-19(25)17(29-20)11-18(24)27-2/h3-9,11,15H,10H2,1-2H3/b17-11-/t15-/m1/s1 |
| InChIKey | LOXXGBGQRUVLRK-QJISPJEISA-N |
| XLogP | 3.13 |
| TPSA | 93.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|