C24H19N3O4S — CID 50740661
(5Z)-5-(furan-2-ylmethylidene)-2-[3-(2-hydroxyphenyl)-5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-1,3-thiazol-4-one (PubChem CID 50740661) has the molecular formula C24H19N3O4S and a molecular weight of 445.50 g/mol. Its IUPAC name is (5Z)-5-(furan-2-ylmethylidene)-2-[3-(2-hydroxyphenyl)-5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-1,3-thiazol-4-one.
| Compound Name | (5Z)-5-(furan-2-ylmethylidene)-2-[3-(2-hydroxyphenyl)-5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 50740661 |
| Molecular Formula | C24H19N3O4S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | (5Z)-5-(furan-2-ylmethylidene)-2-[3-(2-hydroxyphenyl)-5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-1,3-thiazol-4-one |
| SMILES | COc1ccc(C2=NN(C3=NC(=O)/C(=C/c4ccco4)S3)C(c3ccccc3O)C2)cc1 |
| InChI | InChI=1S/C24H19N3O4S/c1-30-16-10-8-15(9-11-16)19-14-20(18-6-2-3-7-21(18)28)27(26-19)24-25-23(29)22(32-24)13-17-5-4-12-31-17/h2-13,20,28H,14H2,1H3/b22-13- |
| InChIKey | RNXFMHYAYRSJJF-XKZIYDEJSA-N |
| XLogP | 4.82 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|