C26H20ClN3O3S — CID 50740955
(5Z)-5-[(5-chloro-2-hydroxyphenyl)methylidene]-2-[3-(4-methoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-1,3-thiazol-4-one (PubChem CID 50740955) has the molecular formula C26H20ClN3O3S and a molecular weight of 489.98 g/mol. Its IUPAC name is (5Z)-5-[(5-chloro-2-hydroxyphenyl)methylidene]-2-[3-(4-methoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-1,3-thiazol-4-one.
| Compound Name | (5Z)-5-[(5-chloro-2-hydroxyphenyl)methylidene]-2-[3-(4-methoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 50740955 |
| Molecular Formula | C26H20ClN3O3S |
| Molecular Weight | 489.98 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | (5Z)-5-[(5-chloro-2-hydroxyphenyl)methylidene]-2-[3-(4-methoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-1,3-thiazol-4-one |
| SMILES | COc1ccc(C2CC(c3ccccc3)=NN2C2=NC(=O)/C(=C/c3cc(Cl)ccc3O)S2)cc1 |
| InChI | InChI=1S/C26H20ClN3O3S/c1-33-20-10-7-17(8-11-20)22-15-21(16-5-3-2-4-6-16)29-30(22)26-28-25(32)24(34-26)14-18-13-19(27)9-12-23(18)31/h2-14,22,31H,15H2,1H3/b24-14- |
| InChIKey | ZUKFVEQJZAJUJG-OYKKKHCWSA-N |
| XLogP | 5.88 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.98 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|