C30H29N3O3S — CID 50740736
(5Z)-5-[(4-tert-butylphenyl)methylidene]-4-[3-(2-hydroxyphenyl)-5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-1,3-thiazol-2-one (PubChem CID 50740736) has the molecular formula C30H29N3O3S and a molecular weight of 511.65 g/mol. Its IUPAC name is (5Z)-5-[(4-tert-butylphenyl)methylidene]-4-[3-(2-hydroxyphenyl)-5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-1,3-thiazol-2-one.
| Compound Name | (5Z)-5-[(4-tert-butylphenyl)methylidene]-4-[3-(2-hydroxyphenyl)-5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 50740736 |
| Molecular Formula | C30H29N3O3S |
| Molecular Weight | 511.65 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | (5Z)-5-[(4-tert-butylphenyl)methylidene]-4-[3-(2-hydroxyphenyl)-5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-1,3-thiazol-2-one |
| SMILES | COc1ccc(C2=NN(C3=NC(=O)S/C3=C\c3ccc(C(C)(C)C)cc3)C(c3ccccc3O)C2)cc1 |
| InChI | InChI=1S/C30H29N3O3S/c1-30(2,3)21-13-9-19(10-14-21)17-27-28(31-29(35)37-27)33-25(23-7-5-6-8-26(23)34)18-24(32-33)20-11-15-22(36-4)16-12-20/h5-17,25,34H,18H2,1-4H3/b27-17- |
| InChIKey | CMJYCFKNQPEIEN-PKAZHMFMSA-N |
| XLogP | 7.16 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.65 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|