C24H20N2O5 — CID 3254809
2-[3-(2-hydroxyphenyl)-5-(4-methoxyphenyl)-3,4-dihydropyrazole-2-carbonyl]benzoic acid (PubChem CID 3254809) has the molecular formula C24H20N2O5 and a molecular weight of 416.43 g/mol. Its IUPAC name is 2-[3-(2-hydroxyphenyl)-5-(4-methoxyphenyl)-3,4-dihydropyrazole-2-carbonyl]benzoic acid.
| Compound Name | 2-[3-(2-hydroxyphenyl)-5-(4-methoxyphenyl)-3,4-dihydropyrazole-2-carbonyl]benzoic acid |
|---|---|
| PubChem CID | 3254809 |
| Molecular Formula | C24H20N2O5 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 2-[3-(2-hydroxyphenyl)-5-(4-methoxyphenyl)-3,4-dihydropyrazole-2-carbonyl]benzoic acid |
| SMILES | COc1ccc(C2=NN(C(=O)c3ccccc3C(=O)O)C(c3ccccc3O)C2)cc1 |
| InChI | InChI=1S/C24H20N2O5/c1-31-16-12-10-15(11-13-16)20-14-21(19-8-4-5-9-22(19)27)26(25-20)23(28)17-6-2-3-7-18(17)24(29)30/h2-13,21,27H,14H2,1H3,(H,29,30) |
| InChIKey | KYIZNTQDIPCPJU-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 99.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|