C23H19ClN2O3 — CID 40554560
(2-chlorophenyl)-[(3S)-3-(2-hydroxyphenyl)-5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]methanone (PubChem CID 40554560) has the molecular formula C23H19ClN2O3 and a molecular weight of 406.87 g/mol. Its IUPAC name is (2-chlorophenyl)-[(3S)-3-(2-hydroxyphenyl)-5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]methanone.
| Compound Name | (2-chlorophenyl)-[(3S)-3-(2-hydroxyphenyl)-5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]methanone |
|---|---|
| PubChem CID | 40554560 |
| Molecular Formula | C23H19ClN2O3 |
| Molecular Weight | 406.87 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | (2-chlorophenyl)-[(3S)-3-(2-hydroxyphenyl)-5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]methanone |
| SMILES | COc1ccc(C2=NN(C(=O)c3ccccc3Cl)[C@H](c3ccccc3O)C2)cc1 |
| InChI | InChI=1S/C23H19ClN2O3/c1-29-16-12-10-15(11-13-16)20-14-21(18-7-3-5-9-22(18)27)26(25-20)23(28)17-6-2-4-8-19(17)24/h2-13,21,27H,14H2,1H3/t21-/m0/s1 |
| InChIKey | KVJZISHZHYRVTL-NRFANRHFSA-N |
| XLogP | 5.05 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.87 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|