C24H19N2O5- — CID 7741724
2-[(3R)-3-(2-hydroxyphenyl)-5-(4-methoxyphenyl)-3,4-dihydropyrazole-2-carbonyl]benzoate (PubChem CID 7741724) has the molecular formula C24H19N2O5- and a molecular weight of 415.43 g/mol. Its IUPAC name is 2-[(3R)-3-(2-hydroxyphenyl)-5-(4-methoxyphenyl)-3,4-dihydropyrazole-2-carbonyl]benzoate.
| Compound Name | 2-[(3R)-3-(2-hydroxyphenyl)-5-(4-methoxyphenyl)-3,4-dihydropyrazole-2-carbonyl]benzoate |
|---|---|
| PubChem CID | 7741724 |
| Molecular Formula | C24H19N2O5- |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 2-[(3R)-3-(2-hydroxyphenyl)-5-(4-methoxyphenyl)-3,4-dihydropyrazole-2-carbonyl]benzoate |
| SMILES | COc1ccc(C2=NN(C(=O)c3ccccc3C(=O)[O-])[C@@H](c3ccccc3O)C2)cc1 |
| InChI | InChI=1S/C24H20N2O5/c1-31-16-12-10-15(11-13-16)20-14-21(19-8-4-5-9-22(19)27)26(25-20)23(28)17-6-2-3-7-18(17)24(29)30/h2-13,21,27H,14H2,1H3,(H,29,30)/p-1/t21-/m1/s1 |
| InChIKey | KYIZNTQDIPCPJU-OAQYLSRUSA-M |
| XLogP | 2.76 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|