C23H17N3O2S2 — CID 50740787
(5Z)-4-[3-(2-hydroxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-5-(thiophen-2-ylmethylidene)-1,3-thiazol-2-one (PubChem CID 50740787) has the molecular formula C23H17N3O2S2 and a molecular weight of 431.54 g/mol. Its IUPAC name is (5Z)-4-[3-(2-hydroxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-5-(thiophen-2-ylmethylidene)-1,3-thiazol-2-one.
| Compound Name | (5Z)-4-[3-(2-hydroxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-5-(thiophen-2-ylmethylidene)-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 50740787 |
| Molecular Formula | C23H17N3O2S2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | (5Z)-4-[3-(2-hydroxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-5-(thiophen-2-ylmethylidene)-1,3-thiazol-2-one |
| SMILES | O=C1N=C(N2N=C(c3ccccc3)CC2c2ccccc2O)/C(=C/c2cccs2)S1 |
| InChI | InChI=1S/C23H17N3O2S2/c27-20-11-5-4-10-17(20)19-14-18(15-7-2-1-3-8-15)25-26(19)22-21(30-23(28)24-22)13-16-9-6-12-29-16/h1-13,19,27H,14H2/b21-13- |
| InChIKey | LSDPMRRNFYQMED-BKUYFWCQSA-N |
| XLogP | 5.91 |
| TPSA | 65.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|