C21H18ClN3O2S — CID 51859425
(5Z)-4-[(3R)-3-(4-chlorophenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-5-(ethoxymethylidene)-1,3-thiazol-2-one (PubChem CID 51859425) has the molecular formula C21H18ClN3O2S and a molecular weight of 411.91 g/mol. Its IUPAC name is (5Z)-4-[(3R)-3-(4-chlorophenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-5-(ethoxymethylidene)-1,3-thiazol-2-one.
| Compound Name | (5Z)-4-[(3R)-3-(4-chlorophenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-5-(ethoxymethylidene)-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 51859425 |
| Molecular Formula | C21H18ClN3O2S |
| Molecular Weight | 411.91 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | (5Z)-4-[(3R)-3-(4-chlorophenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-5-(ethoxymethylidene)-1,3-thiazol-2-one |
| SMILES | CCO/C=C1\SC(=O)N=C1N1N=C(c2ccccc2)C[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H18ClN3O2S/c1-2-27-13-19-20(23-21(26)28-19)25-18(15-8-10-16(22)11-9-15)12-17(24-25)14-6-4-3-5-7-14/h3-11,13,18H,2,12H2,1H3/b19-13-/t18-/m1/s1 |
| InChIKey | SXNNLRQIFUGNPP-ZJYZBMPFSA-N |
| XLogP | 5.63 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.91 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|