C32H25N3O4S2 — CID 127051685
[4-[(5Z)-5-[[3-(4-methoxyphenyl)-5-naphthalen-2-yl-3,4-dihydropyrazol-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]phenyl] acetate (PubChem CID 127051685) has the molecular formula C32H25N3O4S2 and a molecular weight of 579.70 g/mol. Its IUPAC name is [4-[(5Z)-5-[[3-(4-methoxyphenyl)-5-naphthalen-2-yl-3,4-dihydropyrazol-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]phenyl] acetate.
| Compound Name | [4-[(5Z)-5-[[3-(4-methoxyphenyl)-5-naphthalen-2-yl-3,4-dihydropyrazol-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]phenyl] acetate |
|---|---|
| PubChem CID | 127051685 |
| Molecular Formula | C32H25N3O4S2 |
| Molecular Weight | 579.70 g/mol |
| Exact Mass | 579.13 |
| IUPAC Name | [4-[(5Z)-5-[[3-(4-methoxyphenyl)-5-naphthalen-2-yl-3,4-dihydropyrazol-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]phenyl] acetate |
| SMILES | COc1ccc(C2CC(c3ccc4ccccc4c3)=NN2/C=C2\SC(=S)N(c3ccc(OC(C)=O)cc3)C2=O)cc1 |
| InChI | InChI=1S/C32H25N3O4S2/c1-20(36)39-27-15-11-25(12-16-27)35-31(37)30(41-32(35)40)19-34-29(22-9-13-26(38-2)14-10-22)18-28(33-34)24-8-7-21-5-3-4-6-23(21)17-24/h3-17,19,29H,18H2,1-2H3/b30-19- |
| InChIKey | LCOKHWVYKRQRDE-FSGOGVSDSA-N |
| XLogP | 6.83 |
| TPSA | 71.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.70 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|