C33H28N6O4 — CID 98422440
(3aS,6aR)-3-[2-[(3S)-3-(4-methoxyphenyl)-5-naphthalen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-5-(4-methylphenyl)-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione (PubChem CID 98422440) has the molecular formula C33H28N6O4 and a molecular weight of 572.63 g/mol. Its IUPAC name is (3aS,6aR)-3-[2-[(3S)-3-(4-methoxyphenyl)-5-naphthalen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-5-(4-methylphenyl)-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione.
| Compound Name | (3aS,6aR)-3-[2-[(3S)-3-(4-methoxyphenyl)-5-naphthalen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-5-(4-methylphenyl)-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione |
|---|---|
| PubChem CID | 98422440 |
| Molecular Formula | C33H28N6O4 |
| Molecular Weight | 572.63 g/mol |
| Exact Mass | 572.22 |
| IUPAC Name | (3aS,6aR)-3-[2-[(3S)-3-(4-methoxyphenyl)-5-naphthalen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-5-(4-methylphenyl)-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione |
| SMILES | COc1ccc([C@@H]2CC(c3ccc4ccccc4c3)=NN2C(=O)CN2N=N[C@H]3C(=O)N(c4ccc(C)cc4)C(=O)[C@H]32)cc1 |
| InChI | InChI=1S/C33H28N6O4/c1-20-7-13-25(14-8-20)38-32(41)30-31(33(38)42)37(36-34-30)19-29(40)39-28(22-11-15-26(43-2)16-12-22)18-27(35-39)24-10-9-21-5-3-4-6-23(21)17-24/h3-17,28,30-31H,18-19H2,1-2H3/t28-,30+,31-/m0/s1 |
| InChIKey | YYGYPPYTNUGLGR-NBZVVWIMSA-N |
| XLogP | 4.83 |
| TPSA | 107.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.63 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|