C28H19F5N6O4 — CID 4676373
3-[2-[3-(4-methoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-5-(2,3,4,5,6-pentafluorophenyl)-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione (PubChem CID 4676373) has the molecular formula C28H19F5N6O4 and a molecular weight of 598.49 g/mol. Its IUPAC name is 3-[2-[3-(4-methoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-5-(2,3,4,5,6-pentafluorophenyl)-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione.
| Compound Name | 3-[2-[3-(4-methoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-5-(2,3,4,5,6-pentafluorophenyl)-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione |
|---|---|
| PubChem CID | 4676373 |
| Molecular Formula | C28H19F5N6O4 |
| Molecular Weight | 598.49 g/mol |
| Exact Mass | 598.14 |
| IUPAC Name | 3-[2-[3-(4-methoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-5-(2,3,4,5,6-pentafluorophenyl)-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione |
| SMILES | COc1ccc(C2CC(c3ccccc3)=NN2C(=O)CN2N=NC3C(=O)N(c4c(F)c(F)c(F)c(F)c4F)C(=O)C32)cc1 |
| InChI | InChI=1S/C28H19F5N6O4/c1-43-15-9-7-14(8-10-15)17-11-16(13-5-3-2-4-6-13)35-39(17)18(40)12-37-26-24(34-36-37)27(41)38(28(26)42)25-22(32)20(30)19(29)21(31)23(25)33/h2-10,17,24,26H,11-12H2,1H3 |
| InChIKey | ZZNPIEREKWRSKP-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 107.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.49 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|