C33H28N6O5 — CID 98369401
(3aR,6aS)-5-(2-methoxyphenyl)-3-[2-[(3S)-3-(4-methoxyphenyl)-5-naphthalen-1-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione (PubChem CID 98369401) has the molecular formula C33H28N6O5 and a molecular weight of 588.62 g/mol. Its IUPAC name is (3aR,6aS)-5-(2-methoxyphenyl)-3-[2-[(3S)-3-(4-methoxyphenyl)-5-naphthalen-1-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione.
| Compound Name | (3aR,6aS)-5-(2-methoxyphenyl)-3-[2-[(3S)-3-(4-methoxyphenyl)-5-naphthalen-1-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione |
|---|---|
| PubChem CID | 98369401 |
| Molecular Formula | C33H28N6O5 |
| Molecular Weight | 588.62 g/mol |
| Exact Mass | 588.21 |
| IUPAC Name | (3aR,6aS)-5-(2-methoxyphenyl)-3-[2-[(3S)-3-(4-methoxyphenyl)-5-naphthalen-1-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione |
| SMILES | COc1ccc([C@@H]2CC(c3cccc4ccccc34)=NN2C(=O)CN2N=N[C@@H]3C(=O)N(c4ccccc4OC)C(=O)[C@@H]32)cc1 |
| InChI | InChI=1S/C33H28N6O5/c1-43-22-16-14-21(15-17-22)27-18-25(24-11-7-9-20-8-3-4-10-23(20)24)35-39(27)29(40)19-37-31-30(34-36-37)32(41)38(33(31)42)26-12-5-6-13-28(26)44-2/h3-17,27,30-31H,18-19H2,1-2H3/t27-,30-,31+/m0/s1 |
| InChIKey | WNQDERKSDBUULO-FKCXQASGSA-N |
| XLogP | 4.53 |
| TPSA | 116.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.62 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|