C31H30N6O4 — CID 98369412
(3aS,6aS)-3-[2-[(3S)-5-(2,4-dimethylphenyl)-3-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-5-(4-methylphenyl)-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione (PubChem CID 98369412) has the molecular formula C31H30N6O4 and a molecular weight of 550.62 g/mol. Its IUPAC name is (3aS,6aS)-3-[2-[(3S)-5-(2,4-dimethylphenyl)-3-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-5-(4-methylphenyl)-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione.
| Compound Name | (3aS,6aS)-3-[2-[(3S)-5-(2,4-dimethylphenyl)-3-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-5-(4-methylphenyl)-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione |
|---|---|
| PubChem CID | 98369412 |
| Molecular Formula | C31H30N6O4 |
| Molecular Weight | 550.62 g/mol |
| Exact Mass | 550.23 |
| IUPAC Name | (3aS,6aS)-3-[2-[(3S)-5-(2,4-dimethylphenyl)-3-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-5-(4-methylphenyl)-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione |
| SMILES | COc1ccc([C@@H]2CC(c3ccc(C)cc3C)=NN2C(=O)CN2N=N[C@@H]3C(=O)N(c4ccc(C)cc4)C(=O)[C@H]32)cc1 |
| InChI | InChI=1S/C31H30N6O4/c1-18-5-10-22(11-6-18)36-30(39)28-29(31(36)40)35(34-32-28)17-27(38)37-26(21-8-12-23(41-4)13-9-21)16-25(33-37)24-14-7-19(2)15-20(24)3/h5-15,26,28-29H,16-17H2,1-4H3/t26-,28-,29-/m0/s1 |
| InChIKey | OMIUWFJBEBSOLS-ZXRKZBAXSA-N |
| XLogP | 4.29 |
| TPSA | 107.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.62 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|