C28H23ClN6O3 — CID 98272463
(3aS,6aS)-3-[2-[(3S)-5-(4-chlorophenyl)-3-phenyl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-5-(4-methylphenyl)-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione (PubChem CID 98272463) has the molecular formula C28H23ClN6O3 and a molecular weight of 526.98 g/mol. Its IUPAC name is (3aS,6aS)-3-[2-[(3S)-5-(4-chlorophenyl)-3-phenyl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-5-(4-methylphenyl)-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione.
| Compound Name | (3aS,6aS)-3-[2-[(3S)-5-(4-chlorophenyl)-3-phenyl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-5-(4-methylphenyl)-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione |
|---|---|
| PubChem CID | 98272463 |
| Molecular Formula | C28H23ClN6O3 |
| Molecular Weight | 526.98 g/mol |
| Exact Mass | 526.15 |
| IUPAC Name | (3aS,6aS)-3-[2-[(3S)-5-(4-chlorophenyl)-3-phenyl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-5-(4-methylphenyl)-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione |
| SMILES | Cc1ccc(N2C(=O)[C@H]3N=NN(CC(=O)N4N=C(c5ccc(Cl)cc5)C[C@H]4c4ccccc4)[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C28H23ClN6O3/c1-17-7-13-21(14-8-17)34-27(37)25-26(28(34)38)33(32-30-25)16-24(36)35-23(19-5-3-2-4-6-19)15-22(31-35)18-9-11-20(29)12-10-18/h2-14,23,25-26H,15-16H2,1H3/t23-,25-,26-/m0/s1 |
| InChIKey | SOWMTRJNNUVSAC-RNXOBYDBSA-N |
| XLogP | 4.32 |
| TPSA | 98.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.98 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|