C28H23N7O5 — CID 1227837
(3aS,6aR)-5-(4-methylphenyl)-3-[2-[(3S)-3-(4-nitrophenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione (PubChem CID 1227837) has the molecular formula C28H23N7O5 and a molecular weight of 537.54 g/mol. Its IUPAC name is (3aS,6aR)-5-(4-methylphenyl)-3-[2-[(3S)-3-(4-nitrophenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione.
| Compound Name | (3aS,6aR)-5-(4-methylphenyl)-3-[2-[(3S)-3-(4-nitrophenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione |
|---|---|
| PubChem CID | 1227837 |
| Molecular Formula | C28H23N7O5 |
| Molecular Weight | 537.54 g/mol |
| Exact Mass | 537.18 |
| IUPAC Name | (3aS,6aR)-5-(4-methylphenyl)-3-[2-[(3S)-3-(4-nitrophenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione |
| SMILES | Cc1ccc(N2C(=O)[C@@H]3[C@@H](N=NN3CC(=O)N3N=C(c4ccccc4)C[C@H]3c3ccc([N+](=O)[O-])cc3)C2=O)cc1 |
| InChI | InChI=1S/C28H23N7O5/c1-17-7-11-20(12-8-17)33-27(37)25-26(28(33)38)32(31-29-25)16-24(36)34-23(19-9-13-21(14-10-19)35(39)40)15-22(30-34)18-5-3-2-4-6-18/h2-14,23,25-26H,15-16H2,1H3/t23-,25+,26-/m0/s1 |
| InChIKey | IBDAGWQIDOGNGC-DMDYGQEQSA-N |
| XLogP | 3.57 |
| TPSA | 141.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.54 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|