C28H23FN6O4 — CID 6547466
(3aR,6aS)-5-(3-fluorophenyl)-3-[2-[(3S)-3-(4-methoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione (PubChem CID 6547466) has the molecular formula C28H23FN6O4 and a molecular weight of 526.53 g/mol. Its IUPAC name is (3aR,6aS)-5-(3-fluorophenyl)-3-[2-[(3S)-3-(4-methoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione.
| Compound Name | (3aR,6aS)-5-(3-fluorophenyl)-3-[2-[(3S)-3-(4-methoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione |
|---|---|
| PubChem CID | 6547466 |
| Molecular Formula | C28H23FN6O4 |
| Molecular Weight | 526.53 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | (3aR,6aS)-5-(3-fluorophenyl)-3-[2-[(3S)-3-(4-methoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione |
| SMILES | COc1ccc([C@@H]2CC(c3ccccc3)=NN2C(=O)CN2N=N[C@@H]3C(=O)N(c4cccc(F)c4)C(=O)[C@@H]32)cc1 |
| InChI | InChI=1S/C28H23FN6O4/c1-39-21-12-10-18(11-13-21)23-15-22(17-6-3-2-4-7-17)31-35(23)24(36)16-33-26-25(30-32-33)27(37)34(28(26)38)20-9-5-8-19(29)14-20/h2-14,23,25-26H,15-16H2,1H3/t23-,25-,26+/m0/s1 |
| InChIKey | ZRKNTBZKTMDLDC-AYRHNUGRSA-N |
| XLogP | 3.51 |
| TPSA | 107.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.53 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|