C31H23FN6O3 — CID 100823379
(3aS,6aR)-5-(3-fluorophenyl)-3-[2-[(3R)-5-naphthalen-2-yl-3-phenyl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione (PubChem CID 100823379) has the molecular formula C31H23FN6O3 and a molecular weight of 546.56 g/mol. Its IUPAC name is (3aS,6aR)-5-(3-fluorophenyl)-3-[2-[(3R)-5-naphthalen-2-yl-3-phenyl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione.
| Compound Name | (3aS,6aR)-5-(3-fluorophenyl)-3-[2-[(3R)-5-naphthalen-2-yl-3-phenyl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione |
|---|---|
| PubChem CID | 100823379 |
| Molecular Formula | C31H23FN6O3 |
| Molecular Weight | 546.56 g/mol |
| Exact Mass | 546.18 |
| IUPAC Name | (3aS,6aR)-5-(3-fluorophenyl)-3-[2-[(3R)-5-naphthalen-2-yl-3-phenyl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione |
| SMILES | O=C1[C@@H]2[C@@H](N=NN2CC(=O)N2N=C(c3ccc4ccccc4c3)C[C@@H]2c2ccccc2)C(=O)N1c1cccc(F)c1 |
| InChI | InChI=1S/C31H23FN6O3/c32-23-11-6-12-24(16-23)37-30(40)28-29(31(37)41)36(35-33-28)18-27(39)38-26(20-8-2-1-3-9-20)17-25(34-38)22-14-13-19-7-4-5-10-21(19)15-22/h1-16,26,28-29H,17-18H2/t26-,28-,29+/m1/s1 |
| InChIKey | KWTNRJJQQQYHRL-CMYDWJSCSA-N |
| XLogP | 4.65 |
| TPSA | 98.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.56 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|