C27H18F4N6O3 — CID 4766302
3-[2-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)-2-oxoethyl]-5-(2,3,5,6-tetrafluorophenyl)-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione (PubChem CID 4766302) has the molecular formula C27H18F4N6O3 and a molecular weight of 550.47 g/mol. Its IUPAC name is 3-[2-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)-2-oxoethyl]-5-(2,3,5,6-tetrafluorophenyl)-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione.
| Compound Name | 3-[2-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)-2-oxoethyl]-5-(2,3,5,6-tetrafluorophenyl)-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione |
|---|---|
| PubChem CID | 4766302 |
| Molecular Formula | C27H18F4N6O3 |
| Molecular Weight | 550.47 g/mol |
| Exact Mass | 550.14 |
| IUPAC Name | 3-[2-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)-2-oxoethyl]-5-(2,3,5,6-tetrafluorophenyl)-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione |
| SMILES | O=C1C2N=NN(CC(=O)N3N=C(c4ccccc4)CC3c3ccccc3)C2C(=O)N1c1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C27H18F4N6O3/c28-16-11-17(29)22(31)24(21(16)30)36-26(39)23-25(27(36)40)35(34-32-23)13-20(38)37-19(15-9-5-2-6-10-15)12-18(33-37)14-7-3-1-4-8-14/h1-11,19,23,25H,12-13H2 |
| InChIKey | GZUCNTPLJFNDCK-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 98.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.47 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|