C27H19BrCl2N6O3 — CID 100815361
(3aS,6aR)-3-[2-[(3R)-5-(4-bromophenyl)-3-phenyl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-5-(2,6-dichlorophenyl)-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione (PubChem CID 100815361) has the molecular formula C27H19BrCl2N6O3 and a molecular weight of 626.30 g/mol. Its IUPAC name is (3aS,6aR)-3-[2-[(3R)-5-(4-bromophenyl)-3-phenyl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-5-(2,6-dichlorophenyl)-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione.
| Compound Name | (3aS,6aR)-3-[2-[(3R)-5-(4-bromophenyl)-3-phenyl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-5-(2,6-dichlorophenyl)-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione |
|---|---|
| PubChem CID | 100815361 |
| Molecular Formula | C27H19BrCl2N6O3 |
| Molecular Weight | 626.30 g/mol |
| Exact Mass | 624.01 |
| IUPAC Name | (3aS,6aR)-3-[2-[(3R)-5-(4-bromophenyl)-3-phenyl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-5-(2,6-dichlorophenyl)-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione |
| SMILES | O=C1[C@@H]2[C@@H](N=NN2CC(=O)N2N=C(c3ccc(Br)cc3)C[C@@H]2c2ccccc2)C(=O)N1c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C27H19BrCl2N6O3/c28-17-11-9-15(10-12-17)20-13-21(16-5-2-1-3-6-16)36(32-20)22(37)14-34-25-23(31-33-34)26(38)35(27(25)39)24-18(29)7-4-8-19(24)30/h1-12,21,23,25H,13-14H2/t21-,23-,25+/m1/s1 |
| InChIKey | LIUXDEHBQUIULJ-PFATUAPWSA-N |
| XLogP | 5.43 |
| TPSA | 98.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.30 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|