C27H23FN6O6 — CID 98372706
(3aR,6aS)-3-[2-[(3S)-5-(3,4-dimethoxyphenyl)-3-(furan-2-yl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-5-(3-fluorophenyl)-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione (PubChem CID 98372706) has the molecular formula C27H23FN6O6 and a molecular weight of 546.52 g/mol. Its IUPAC name is (3aR,6aS)-3-[2-[(3S)-5-(3,4-dimethoxyphenyl)-3-(furan-2-yl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-5-(3-fluorophenyl)-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione.
| Compound Name | (3aR,6aS)-3-[2-[(3S)-5-(3,4-dimethoxyphenyl)-3-(furan-2-yl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-5-(3-fluorophenyl)-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione |
|---|---|
| PubChem CID | 98372706 |
| Molecular Formula | C27H23FN6O6 |
| Molecular Weight | 546.52 g/mol |
| Exact Mass | 546.17 |
| IUPAC Name | (3aR,6aS)-3-[2-[(3S)-5-(3,4-dimethoxyphenyl)-3-(furan-2-yl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-5-(3-fluorophenyl)-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione |
| SMILES | COc1ccc(C2=NN(C(=O)CN3N=N[C@@H]4C(=O)N(c5cccc(F)c5)C(=O)[C@@H]43)[C@H](c3ccco3)C2)cc1OC |
| InChI | InChI=1S/C27H23FN6O6/c1-38-21-9-8-15(11-22(21)39-2)18-13-19(20-7-4-10-40-20)34(30-18)23(35)14-32-25-24(29-31-32)26(36)33(27(25)37)17-6-3-5-16(28)12-17/h3-12,19,24-25H,13-14H2,1-2H3/t19-,24-,25+/m0/s1 |
| InChIKey | JAKGSZFHAWFAGP-PNTFMKQHSA-N |
| XLogP | 3.11 |
| TPSA | 129.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.52 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|