C25H21N3O3S2 — CID 118712181
(5Z)-3-(furan-2-ylmethyl)-5-[[3-(4-methoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 118712181) has the molecular formula C25H21N3O3S2 and a molecular weight of 475.60 g/mol. Its IUPAC name is (5Z)-3-(furan-2-ylmethyl)-5-[[3-(4-methoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-(furan-2-ylmethyl)-5-[[3-(4-methoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 118712181 |
| Molecular Formula | C25H21N3O3S2 |
| Molecular Weight | 475.60 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | (5Z)-3-(furan-2-ylmethyl)-5-[[3-(4-methoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(C2CC(c3ccccc3)=NN2/C=C2\SC(=S)N(Cc3ccco3)C2=O)cc1 |
| InChI | InChI=1S/C25H21N3O3S2/c1-30-19-11-9-18(10-12-19)22-14-21(17-6-3-2-4-7-17)26-28(22)16-23-24(29)27(25(32)33-23)15-20-8-5-13-31-20/h2-13,16,22H,14-15H2,1H3/b23-16- |
| InChIKey | IHWBRIMRQHOOAC-KQWNVCNZSA-N |
| XLogP | 5.34 |
| TPSA | 58.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.60 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|