C28H20N2O2 — CID 20685192
6-(2,3-diphenyl-3,4-dihydropyrazol-5-yl)phenalene-1,3-dione (PubChem CID 20685192) has the molecular formula C28H20N2O2 and a molecular weight of 416.48 g/mol. Its IUPAC name is 6-(2,3-diphenyl-3,4-dihydropyrazol-5-yl)phenalene-1,3-dione.
| Compound Name | 6-(2,3-diphenyl-3,4-dihydropyrazol-5-yl)phenalene-1,3-dione |
|---|---|
| PubChem CID | 20685192 |
| Molecular Formula | C28H20N2O2 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 6-(2,3-diphenyl-3,4-dihydropyrazol-5-yl)phenalene-1,3-dione |
| SMILES | O=C1CC(=O)c2ccc(C3=NN(c4ccccc4)C(c4ccccc4)C3)c3cccc1c23 |
| InChI | InChI=1S/C28H20N2O2/c31-26-17-27(32)23-15-14-20(21-12-7-13-22(26)28(21)23)24-16-25(18-8-3-1-4-9-18)30(29-24)19-10-5-2-6-11-19/h1-15,25H,16-17H2 |
| InChIKey | SMFFKGHWSAOCFQ-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|