C26H19Cl2N3O2 — CID 86819945
[3-(2-chloro-8-methoxyquinolin-3-yl)-5-(3-chlorophenyl)-3,4-dihydropyrazol-2-yl]-phenylmethanone (PubChem CID 86819945) has the molecular formula C26H19Cl2N3O2 and a molecular weight of 476.36 g/mol. Its IUPAC name is [3-(2-chloro-8-methoxyquinolin-3-yl)-5-(3-chlorophenyl)-3,4-dihydropyrazol-2-yl]-phenylmethanone.
| Compound Name | [3-(2-chloro-8-methoxyquinolin-3-yl)-5-(3-chlorophenyl)-3,4-dihydropyrazol-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 86819945 |
| Molecular Formula | C26H19Cl2N3O2 |
| Molecular Weight | 476.36 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | [3-(2-chloro-8-methoxyquinolin-3-yl)-5-(3-chlorophenyl)-3,4-dihydropyrazol-2-yl]-phenylmethanone |
| SMILES | COc1cccc2cc(C3CC(c4cccc(Cl)c4)=NN3C(=O)c3ccccc3)c(Cl)nc12 |
| InChI | InChI=1S/C26H19Cl2N3O2/c1-33-23-12-6-10-18-14-20(25(28)29-24(18)23)22-15-21(17-9-5-11-19(27)13-17)30-31(22)26(32)16-7-3-2-4-8-16/h2-14,22H,15H2,1H3 |
| InChIKey | UZBSSZKHMJVLSU-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.36 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|